C36H36N4Pt — CID 58084661
2,3,7,8,12,13-hexaethyl-17,18-diethynylporphyrin-22,24-diide;platinum(2+) (PubChem CID 58084661) has the molecular formula C36H36N4Pt and a molecular weight of 719.79 g/mol. Its IUPAC name is 2,3,7,8,12,13-hexaethyl-17,18-diethynylporphyrin-22,24-diide;platinum(2+).
| Compound Name | 2,3,7,8,12,13-hexaethyl-17,18-diethynylporphyrin-22,24-diide;platinum(2+) |
|---|---|
| PubChem CID | 58084661 |
| Molecular Formula | C36H36N4Pt |
| Molecular Weight | 719.79 g/mol |
| Exact Mass | 719.26 |
| IUPAC Name | 2,3,7,8,12,13-hexaethyl-17,18-diethynylporphyrin-22,24-diide;platinum(2+) |
| SMILES | C#Cc1c(C#C)c2cc3nc(cc4[n-]c(cc5nc(cc1[n-]2)C(CC)=C5CC)c(CC)c4CC)C(CC)=C3CC.[Pt+2] |
| InChI | InChI=1S/C36H36N4.Pt/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h1-2,17-20H,11-16H2,3-8H3;/q-2;+2/b29-17-,30-18-,31-17-,32-18-,33-19-,34-20-,35-19-,36-20-; |
| InChIKey | AZBJYOZQUDEKNA-XTPDIVBZSA-N |
| XLogP | 8.12 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.79 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|