C27H9F3N8 — CID 58084837
18,19-diisocyano-10-[4-(trifluoromethyl)phenyl]-3,6,15,17,20,22-hexazahexacyclo[11.10.1.02,7.09,24.014,23.016,21]tetracosa-1,3,5,7,9,11,13(24),14(23),15,17,19,21-dodecaene (PubChem CID 58084837) has the molecular formula C27H9F3N8 and a molecular weight of 502.42 g/mol. Its IUPAC name is 18,19-diisocyano-10-[4-(trifluoromethyl)phenyl]-3,6,15,17,20,22-hexazahexacyclo[11.10.1.02,7.09,24.014,23.016,21]tetracosa-1,3,5,7,9,11,13(24),14(23),15,17,19,21-dodecaene.
| Compound Name | 18,19-diisocyano-10-[4-(trifluoromethyl)phenyl]-3,6,15,17,20,22-hexazahexacyclo[11.10.1.02,7.09,24.014,23.016,21]tetracosa-1,3,5,7,9,11,13(24),14(23),15,17,19,21-dodecaene |
|---|---|
| PubChem CID | 58084837 |
| Molecular Formula | C27H9F3N8 |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 18,19-diisocyano-10-[4-(trifluoromethyl)phenyl]-3,6,15,17,20,22-hexazahexacyclo[11.10.1.02,7.09,24.014,23.016,21]tetracosa-1,3,5,7,9,11,13(24),14(23),15,17,19,21-dodecaene |
| SMILES | [C-]#[N+]c1nc2nc3c(nc2nc1[N+]#[C-])-c1c2nccnc2cc2c(-c4ccc(C(F)(F)F)cc4)ccc-3c12 |
| InChI | InChI=1S/C27H9F3N8/c1-31-23-24(32-2)38-26-25(37-23)35-20-15-8-7-14(12-3-5-13(6-4-12)27(28,29)30)16-11-17-21(34-10-9-33-17)19(18(15)16)22(20)36-26/h3-11H |
| InChIKey | OPCCGDRXWPXUCD-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 86.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|