C22F4N12 — CID 58084843
13,14,15,16-tetrafluoro-3,5,8,10,19,21,24,26-octazahexacyclo[16.8.0.02,11.04,9.012,17.020,25]hexacosa-1(26),2,4,6,8,10,12(17),13,15,18,20,22,24-tridecaene-6,7,22,23-tetracarbonitrile (PubChem CID 58084843) has the molecular formula C22F4N12 and a molecular weight of 508.32 g/mol. Its IUPAC name is 13,14,15,16-tetrafluoro-3,5,8,10,19,21,24,26-octazahexacyclo[16.8.0.02,11.04,9.012,17.020,25]hexacosa-1(26),2,4,6,8,10,12(17),13,15,18,20,22,24-tridecaene-6,7,22,23-tetracarbonitrile.
| Compound Name | 13,14,15,16-tetrafluoro-3,5,8,10,19,21,24,26-octazahexacyclo[16.8.0.02,11.04,9.012,17.020,25]hexacosa-1(26),2,4,6,8,10,12(17),13,15,18,20,22,24-tridecaene-6,7,22,23-tetracarbonitrile |
|---|---|
| PubChem CID | 58084843 |
| Molecular Formula | C22F4N12 |
| Molecular Weight | 508.32 g/mol |
| Exact Mass | 508.03 |
| IUPAC Name | 13,14,15,16-tetrafluoro-3,5,8,10,19,21,24,26-octazahexacyclo[16.8.0.02,11.04,9.012,17.020,25]hexacosa-1(26),2,4,6,8,10,12(17),13,15,18,20,22,24-tridecaene-6,7,22,23-tetracarbonitrile |
| SMILES | N#Cc1nc2nc3c4nc5nc(C#N)c(C#N)nc5nc4c4c(F)c(F)c(F)c(F)c4c3nc2nc1C#N |
| InChI | InChI=1S/C22F4N12/c23-11-9-10(12(24)14(26)13(11)25)16-18(38-22-20(36-16)32-6(2-28)8(4-30)34-22)17-15(9)35-19-21(37-17)33-7(3-29)5(1-27)31-19 |
| InChIKey | JNJUVXHJMFGQHR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 198.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|