C22H4F12N8 — CID 58084858
6,7,22,23-tetrakis(trifluoromethyl)-3,5,8,10,19,21,24,26-octazahexacyclo[16.8.0.02,11.04,9.012,17.020,25]hexacosa-1(18),2(11),3,5,7,9,12,14,16,19,21,23,25-tridecaene (PubChem CID 58084858) has the molecular formula C22H4F12N8 and a molecular weight of 608.31 g/mol. Its IUPAC name is 6,7,22,23-tetrakis(trifluoromethyl)-3,5,8,10,19,21,24,26-octazahexacyclo[16.8.0.02,11.04,9.012,17.020,25]hexacosa-1(18),2(11),3,5,7,9,12,14,16,19,21,23,25-tridecaene.
| Compound Name | 6,7,22,23-tetrakis(trifluoromethyl)-3,5,8,10,19,21,24,26-octazahexacyclo[16.8.0.02,11.04,9.012,17.020,25]hexacosa-1(18),2(11),3,5,7,9,12,14,16,19,21,23,25-tridecaene |
|---|---|
| PubChem CID | 58084858 |
| Molecular Formula | C22H4F12N8 |
| Molecular Weight | 608.31 g/mol |
| Exact Mass | 608.04 |
| IUPAC Name | 6,7,22,23-tetrakis(trifluoromethyl)-3,5,8,10,19,21,24,26-octazahexacyclo[16.8.0.02,11.04,9.012,17.020,25]hexacosa-1(18),2(11),3,5,7,9,12,14,16,19,21,23,25-tridecaene |
| SMILES | FC(F)(F)c1nc2nc3c4ccccc4c4nc5nc(C(F)(F)F)c(C(F)(F)F)nc5nc4c3nc2nc1C(F)(F)F |
| InChI | InChI=1S/C22H4F12N8/c23-19(24,25)11-13(21(29,30)31)41-17-15(39-11)35-7-5-3-1-2-4-6(5)8-10(9(7)37-17)38-18-16(36-8)40-12(20(26,27)28)14(42-18)22(32,33)34/h1-4H |
| InChIKey | LAMCLURBXFGLNT-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.31 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|