C14H2F4N8 — CID 58084892
7,8,18,19-tetrafluoro-4,6,9,11,15,17,20,22-octazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene (PubChem CID 58084892) has the molecular formula C14H2F4N8 and a molecular weight of 358.22 g/mol. Its IUPAC name is 7,8,18,19-tetrafluoro-4,6,9,11,15,17,20,22-octazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene.
| Compound Name | 7,8,18,19-tetrafluoro-4,6,9,11,15,17,20,22-octazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene |
|---|---|
| PubChem CID | 58084892 |
| Molecular Formula | C14H2F4N8 |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 7,8,18,19-tetrafluoro-4,6,9,11,15,17,20,22-octazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene |
| SMILES | Fc1nc2nc3cc4nc5nc(F)c(F)nc5nc4cc3nc2nc1F |
| InChI | InChI=1S/C14H2F4N8/c15-7-9(17)25-13-11(23-7)19-3-1-4-6(2-5(3)21-13)22-14-12(20-4)24-8(16)10(18)26-14/h1-2H |
| InChIKey | PBGCYRUKYQZXJO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|