C28H10N6 — CID 58084949
6,7-diisocyano-3,5,8,10-tetrazaoctacyclo[13.12.2.116,20.02,11.04,9.012,28.025,29.024,30]triaconta-1(28),2(11),3,5,7,9,12,14,16,18,20(30),21,23,25(29),26-pentadecaene (PubChem CID 58084949) has the molecular formula C28H10N6 and a molecular weight of 430.43 g/mol. Its IUPAC name is 6,7-diisocyano-3,5,8,10-tetrazaoctacyclo[13.12.2.116,20.02,11.04,9.012,28.025,29.024,30]triaconta-1(28),2(11),3,5,7,9,12,14,16,18,20(30),21,23,25(29),26-pentadecaene.
| Compound Name | 6,7-diisocyano-3,5,8,10-tetrazaoctacyclo[13.12.2.116,20.02,11.04,9.012,28.025,29.024,30]triaconta-1(28),2(11),3,5,7,9,12,14,16,18,20(30),21,23,25(29),26-pentadecaene |
|---|---|
| PubChem CID | 58084949 |
| Molecular Formula | C28H10N6 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 6,7-diisocyano-3,5,8,10-tetrazaoctacyclo[13.12.2.116,20.02,11.04,9.012,28.025,29.024,30]triaconta-1(28),2(11),3,5,7,9,12,14,16,18,20(30),21,23,25(29),26-pentadecaene |
| SMILES | [C-]#[N+]c1nc2nc3c(nc2nc1[N+]#[C-])-c1ccc2c4cccc5cccc(c6ccc-3c1c62)c54 |
| InChI | InChI=1S/C28H10N6/c1-29-25-26(30-2)34-28-27(33-25)31-23-18-11-9-16-14-7-3-5-13-6-4-8-15(20(13)14)17-10-12-19(24(23)32-28)22(18)21(16)17/h3-12H |
| InChIKey | NPEAPWFYDMSOHT-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 60.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|