C7H24O10Si5 — CID 58085226
2,6-dimethoxy-2,4,6,8,10-pentamethyl-4,8,10-tritritiooxy-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 58085226) has the molecular formula C7H24O10Si5 and a molecular weight of 414.71 g/mol. Its IUPAC name is 2,6-dimethoxy-2,4,6,8,10-pentamethyl-4,8,10-tritritiooxy-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,6-dimethoxy-2,4,6,8,10-pentamethyl-4,8,10-tritritiooxy-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 58085226 |
| Molecular Formula | C7H24O10Si5 |
| Molecular Weight | 414.71 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 2,6-dimethoxy-2,4,6,8,10-pentamethyl-4,8,10-tritritiooxy-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | [3H]O[Si]1(C)O[Si](C)(O[3H])O[Si](C)(OC)O[Si](C)(O[3H])O[Si](C)(OC)O1 |
| InChI | InChI=1S/C7H24O10Si5/c1-11-21(6)14-18(3,8)13-19(4,9)15-22(7,12-2)17-20(5,10)16-21/h8-10H,1-7H3/i8T,9T,10T |
| InChIKey | AYXSKSOVCIILQZ-DJGKLNHRSA-N |
| XLogP | -0.80 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.71 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|