C12H2Cl6F2N4 — CID 58085234
2-(2,6-difluoro-4-isocyanophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 58085234) has the molecular formula C12H2Cl6F2N4 and a molecular weight of 452.89 g/mol. Its IUPAC name is 2-(2,6-difluoro-4-isocyanophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-(2,6-difluoro-4-isocyanophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58085234 |
| Molecular Formula | C12H2Cl6F2N4 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 449.84 |
| IUPAC Name | 2-(2,6-difluoro-4-isocyanophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | [C-]#[N+]c1cc(F)c(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)c(F)c1 |
| InChI | InChI=1S/C12H2Cl6F2N4/c1-21-4-2-5(19)7(6(20)3-4)8-22-9(11(13,14)15)24-10(23-8)12(16,17)18/h2-3H |
| InChIKey | BNFPTBCYKKSQRU-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|