C28H31Cl6N5O6Si — CID 58085394
[4-[[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]carbamoyl]phenyl] N-(3-triethoxysilylpropyl)carbamate (PubChem CID 58085394) has the molecular formula C28H31Cl6N5O6Si and a molecular weight of 774.39 g/mol. Its IUPAC name is [4-[[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]carbamoyl]phenyl] N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | [4-[[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]carbamoyl]phenyl] N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 58085394 |
| Molecular Formula | C28H31Cl6N5O6Si |
| Molecular Weight | 774.39 g/mol |
| Exact Mass | 771.02 |
| IUPAC Name | [4-[[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]carbamoyl]phenyl] N-(3-triethoxysilylpropyl)carbamate |
| SMILES | CCO[Si](CCCNC(=O)Oc1ccc(C(=O)Nc2ccc(-c3nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n3)cc2)cc1)(OCC)OCC |
| InChI | InChI=1S/C28H31Cl6N5O6Si/c1-4-42-46(43-5-2,44-6-3)17-7-16-35-26(41)45-21-14-10-19(11-15-21)23(40)36-20-12-8-18(9-13-20)22-37-24(27(29,30)31)39-25(38-22)28(32,33)34/h8-15H,4-7,16-17H2,1-3H3,(H,35,41)(H,36,40) |
| InChIKey | NMUTWCJNVSSATQ-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.39 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|