C25H25Cl6N5O6Si — CID 58085395
[4-[[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]carbamoyl]phenyl] N-(3-trimethoxysilylpropyl)carbamate (PubChem CID 58085395) has the molecular formula C25H25Cl6N5O6Si and a molecular weight of 732.31 g/mol. Its IUPAC name is [4-[[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]carbamoyl]phenyl] N-(3-trimethoxysilylpropyl)carbamate.
| Compound Name | [4-[[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]carbamoyl]phenyl] N-(3-trimethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 58085395 |
| Molecular Formula | C25H25Cl6N5O6Si |
| Molecular Weight | 732.31 g/mol |
| Exact Mass | 728.97 |
| IUPAC Name | [4-[[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]carbamoyl]phenyl] N-(3-trimethoxysilylpropyl)carbamate |
| SMILES | CO[Si](CCCNC(=O)Oc1ccc(C(=O)Nc2ccc(-c3nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n3)cc2)cc1)(OC)OC |
| InChI | InChI=1S/C25H25Cl6N5O6Si/c1-39-43(40-2,41-3)14-4-13-32-23(38)42-18-11-7-16(8-12-18)20(37)33-17-9-5-15(6-10-17)19-34-21(24(26,27)28)36-22(35-19)25(29,30)31/h5-12H,4,13-14H2,1-3H3,(H,32,38)(H,33,37) |
| InChIKey | NBIUOVKXAREMDE-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.31 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|