C45H28N4 — CID 58085428
4-(2',7,7'-tripyridin-4-yl-9,9'-spirobi[fluorene]-2-yl)pyridine (PubChem CID 58085428) has the molecular formula C45H28N4 and a molecular weight of 624.75 g/mol. Its IUPAC name is 4-(2',7,7'-tripyridin-4-yl-9,9'-spirobi[fluorene]-2-yl)pyridine.
| Compound Name | 4-(2',7,7'-tripyridin-4-yl-9,9'-spirobi[fluorene]-2-yl)pyridine |
|---|---|
| PubChem CID | 58085428 |
| Molecular Formula | C45H28N4 |
| Molecular Weight | 624.75 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | 4-(2',7,7'-tripyridin-4-yl-9,9'-spirobi[fluorene]-2-yl)pyridine |
| SMILES | c1cc(-c2ccc3c(c2)C2(c4cc(-c5ccncc5)ccc4-3)c3cc(-c4ccncc4)ccc3-c3ccc(-c4ccncc4)cc32)ccn1 |
| InChI | InChI=1S/C45H28N4/c1-5-37-38-6-2-34(30-11-19-47-20-12-30)26-42(38)45(41(37)25-33(1)29-9-17-46-18-10-29)43-27-35(31-13-21-48-22-14-31)3-7-39(43)40-8-4-36(28-44(40)45)32-15-23-49-24-16-32/h1-28H |
| InChIKey | TYCOVBAVFRJWPA-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.75 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |