C34H34BNO2 — CID 58085461
N,N-bis(4-methylphenyl)-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anthracen-9-amine (PubChem CID 58085461) has the molecular formula C34H34BNO2 and a molecular weight of 499.46 g/mol. Its IUPAC name is N,N-bis(4-methylphenyl)-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anthracen-9-amine.
| Compound Name | N,N-bis(4-methylphenyl)-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anthracen-9-amine |
|---|---|
| PubChem CID | 58085461 |
| Molecular Formula | C34H34BNO2 |
| Molecular Weight | 499.46 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | N,N-bis(4-methylphenyl)-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anthracen-9-amine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2c3ccccc3c(B3OC(C)(C)C(C)(C)O3)c3ccccc23)cc1 |
| InChI | InChI=1S/C34H34BNO2/c1-23-15-19-25(20-16-23)36(26-21-17-24(2)18-22-26)32-29-13-9-7-11-27(29)31(28-12-8-10-14-30(28)32)35-37-33(3,4)34(5,6)38-35/h7-22H,1-6H3 |
| InChIKey | BPYBNEUXAHZYCN-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.46 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|