C64H76 — CID 58085549
1,3-bis[3-[bis(2,4,5-trimethylphenyl)methyl]-4,5-dimethylphenyl]adamantane (PubChem CID 58085549) has the molecular formula C64H76 and a molecular weight of 845.31 g/mol. Its IUPAC name is 1,3-bis[3-[bis(2,4,5-trimethylphenyl)methyl]-4,5-dimethylphenyl]adamantane.
| Compound Name | 1,3-bis[3-[bis(2,4,5-trimethylphenyl)methyl]-4,5-dimethylphenyl]adamantane |
|---|---|
| PubChem CID | 58085549 |
| Molecular Formula | C64H76 |
| Molecular Weight | 845.31 g/mol |
| Exact Mass | 844.59 |
| IUPAC Name | 1,3-bis[3-[bis(2,4,5-trimethylphenyl)methyl]-4,5-dimethylphenyl]adamantane |
| SMILES | Cc1cc(C)c(C(c2cc(C)c(C)cc2C)c2cc(C34CC5CC(C3)CC(c3cc(C)c(C)c(C(c6cc(C)c(C)cc6C)c6cc(C)c(C)cc6C)c3)(C5)C4)cc(C)c2C)cc1C |
| InChI | InChI=1S/C64H76/c1-35-17-45(11)55(23-39(35)5)61(56-24-40(6)36(2)18-46(56)12)59-28-53(21-43(9)49(59)15)63-30-51-27-52(31-63)33-64(32-51,34-63)54-22-44(10)50(16)60(29-54)62(57-25-41(7)37(3)19-47(57)13)58-26-42(8)38(4)20-48(58)14/h17-26,28-29,51-52,61-62H,27,30-34H2,1-16H3 |
| InChIKey | LVIYTXFKYCBPFF-UHFFFAOYSA-N |
| XLogP | 16.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.31 |
| LogP ≤ 5 | 16.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|