C48H68 — CID 58085565
2,7-ditert-butyl-9-[1-(2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-en-2-yl]-4b,8a,9,9a-tetrahydro-4aH-fluorene (PubChem CID 58085565) has the molecular formula C48H68 and a molecular weight of 645.07 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-[1-(2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-en-2-yl]-4b,8a,9,9a-tetrahydro-4aH-fluorene.
| Compound Name | 2,7-ditert-butyl-9-[1-(2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-en-2-yl]-4b,8a,9,9a-tetrahydro-4aH-fluorene |
|---|---|
| PubChem CID | 58085565 |
| Molecular Formula | C48H68 |
| Molecular Weight | 645.07 g/mol |
| Exact Mass | 644.53 |
| IUPAC Name | 2,7-ditert-butyl-9-[1-(2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-en-2-yl]-4b,8a,9,9a-tetrahydro-4aH-fluorene |
| SMILES | C=CCCC(CC1C2C=C(C(C)(C)C)C=CC2C2C=CC(C(C)(C)C)=CC21)C1C2C=C(C(C)(C)C)C=CC2C2C=CC(C(C)(C)C)=CC21 |
| InChI | InChI=1S/C48H68/c1-14-15-16-30(44-42-28-33(47(8,9)10)19-23-37(42)38-24-20-34(29-43(38)44)48(11,12)13)25-39-40-26-31(45(2,3)4)17-21-35(40)36-22-18-32(27-41(36)39)46(5,6)7/h14,17-24,26-30,35-44H,1,15-16,25H2,2-13H3 |
| InChIKey | INPUXUIUMYRHMC-UHFFFAOYSA-N |
| XLogP | 13.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.07 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|