C45H62 — CID 58085567
2,7-ditert-butyl-9-[2-(2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-enyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene (PubChem CID 58085567) has the molecular formula C45H62 and a molecular weight of 602.99 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-[2-(2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-enyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene.
| Compound Name | 2,7-ditert-butyl-9-[2-(2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-enyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene |
|---|---|
| PubChem CID | 58085567 |
| Molecular Formula | C45H62 |
| Molecular Weight | 602.99 g/mol |
| Exact Mass | 602.49 |
| IUPAC Name | 2,7-ditert-butyl-9-[2-(2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-enyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene |
| SMILES | C=CCCC(CC1C2C=C(C(C)(C)C)C=CC2C2C=CC(C(C)(C)C)=CC21)C1C2C=C(C)C=CC2C2C=CC(C(C)(C)C)=CC21 |
| InChI | InChI=1S/C45H62/c1-12-13-14-29(42-40-23-28(2)15-19-35(40)36-22-18-32(27-41(36)42)45(9,10)11)24-37-38-25-30(43(3,4)5)16-20-33(38)34-21-17-31(26-39(34)37)44(6,7)8/h12,15-23,25-27,29,33-42H,1,13-14,24H2,2-11H3 |
| InChIKey | FXMKYMZZDYGZLP-UHFFFAOYSA-N |
| XLogP | 12.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.99 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|