C37H46 — CID 58085568
9-[2-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-enyl]-2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene (PubChem CID 58085568) has the molecular formula C37H46 and a molecular weight of 490.78 g/mol. Its IUPAC name is 9-[2-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-enyl]-2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene.
| Compound Name | 9-[2-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-enyl]-2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene |
|---|---|
| PubChem CID | 58085568 |
| Molecular Formula | C37H46 |
| Molecular Weight | 490.78 g/mol |
| Exact Mass | 490.36 |
| IUPAC Name | 9-[2-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-enyl]-2-tert-butyl-7-methyl-4b,8a,9,9a-tetrahydro-4aH-fluorene |
| SMILES | C=CCCC(CC1C2C=C(C)C=CC2C2C=CC(C(C)(C)C)=CC21)C1C2C=CC=CC2C2C=CC=CC21 |
| InChI | InChI=1S/C37H46/c1-6-7-12-25(36-31-15-10-8-13-27(31)28-14-9-11-16-32(28)36)22-34-33-21-24(2)17-19-29(33)30-20-18-26(23-35(30)34)37(3,4)5/h6,8-11,13-21,23,25,27-36H,1,7,12,22H2,2-5H3 |
| InChIKey | AVZGMCOWJKEENC-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.78 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|