C22H17F2N3O3 — CID 58086782
[2,6-difluoro-3-(2-methoxyethoxy)phenyl]-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone (PubChem CID 58086782) has the molecular formula C22H17F2N3O3 and a molecular weight of 409.39 g/mol. Its IUPAC name is [2,6-difluoro-3-(2-methoxyethoxy)phenyl]-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone.
| Compound Name | [2,6-difluoro-3-(2-methoxyethoxy)phenyl]-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 58086782 |
| Molecular Formula | C22H17F2N3O3 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | [2,6-difluoro-3-(2-methoxyethoxy)phenyl]-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
| SMILES | COCCOc1ccc(F)c(C(=O)c2c[nH]c3ncc(-c4cccnc4)cc23)c1F |
| InChI | InChI=1S/C22H17F2N3O3/c1-29-7-8-30-18-5-4-17(23)19(20(18)24)21(28)16-12-27-22-15(16)9-14(11-26-22)13-3-2-6-25-10-13/h2-6,9-12H,7-8H2,1H3,(H,26,27) |
| InChIKey | IOTAYYFNYFUMMB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|