C23H27FN2O2 — CID 58086822
3-[[4-(3-cyclopentylpropoxy)-2-fluoro-5-methoxyphenyl]methyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 58086822) has the molecular formula C23H27FN2O2 and a molecular weight of 382.48 g/mol. Its IUPAC name is 3-[[4-(3-cyclopentylpropoxy)-2-fluoro-5-methoxyphenyl]methyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[[4-(3-cyclopentylpropoxy)-2-fluoro-5-methoxyphenyl]methyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 58086822 |
| Molecular Formula | C23H27FN2O2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 3-[[4-(3-cyclopentylpropoxy)-2-fluoro-5-methoxyphenyl]methyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COc1cc(Cc2c[nH]c3ncccc23)c(F)cc1OCCCC1CCCC1 |
| InChI | InChI=1S/C23H27FN2O2/c1-27-21-13-17(12-18-15-26-23-19(18)9-4-10-25-23)20(24)14-22(21)28-11-5-8-16-6-2-3-7-16/h4,9-10,13-16H,2-3,5-8,11-12H2,1H3,(H,25,26) |
| InChIKey | DSPMSEJXKFHFHX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|