About [3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol
[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol (PubChem CID 58086854) has the molecular formula C14H12N2O
and a molecular weight of 224.26 g/mol. Its IUPAC name is [3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol.
Molecular Properties
| Compound Name | [3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol |
| PubChem CID | 58086854 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | [3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol |
| SMILES | OCc1cccc(-c2cnc3[nH]ccc3c2)c1 |
| InChI | InChI=1S/C14H12N2O/c17-9-10-2-1-3-11(6-10)13-7-12-4-5-15-14(12)16-8-13/h1-8,17H,9H2,(H,15,16) |
| InChIKey | SXKCOFMVBVDURQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol?
The IUPAC name of [3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol (CID 58086854) is [3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol.
What is the SMILES notation for [3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol?
The canonical SMILES for [3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol is OCc1cccc(-c2cnc3[nH]ccc3c2)c1.
What is the InChIKey of [3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol?
The InChIKey is SXKCOFMVBVDURQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O/c17-9-10-2-1-3-11(6-10)13-7-12-4-5-15-14(12)16-8-13/h1-8,17H,9H2,(H,15,16).
What are the key properties of [3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol?
[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol has a molecular weight of 224.26 g/mol, XLogP of 2.72, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol is sourced from PubChem (CID 58086854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).