C20H22F2N4O3 — CID 58087430
1-butyl-3-[2,4-difluoro-3-[hydroxy-(5-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]phenyl]urea (PubChem CID 58087430) has the molecular formula C20H22F2N4O3 and a molecular weight of 404.42 g/mol. Its IUPAC name is 1-butyl-3-[2,4-difluoro-3-[hydroxy-(5-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]phenyl]urea.
| Compound Name | 1-butyl-3-[2,4-difluoro-3-[hydroxy-(5-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 58087430 |
| Molecular Formula | C20H22F2N4O3 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-butyl-3-[2,4-difluoro-3-[hydroxy-(5-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]phenyl]urea |
| SMILES | CCCCNC(=O)Nc1ccc(F)c(C(O)c2c[nH]c3ncc(OC)cc23)c1F |
| InChI | InChI=1S/C20H22F2N4O3/c1-3-4-7-23-20(28)26-15-6-5-14(21)16(17(15)22)18(27)13-10-25-19-12(13)8-11(29-2)9-24-19/h5-6,8-10,18,27H,3-4,7H2,1-2H3,(H,24,25)(H2,23,26,28) |
| InChIKey | MCSXTXRSPKRNST-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|