C30H32ClN5O2 — CID 58087653
N-butyl-4-[[5-(3-chloro-N-ethyl-4-methoxyanilino)-1H-pyrrolo[2,3-b]pyridin-3-yl]methyl]indole-1-carboxamide (PubChem CID 58087653) has the molecular formula C30H32ClN5O2 and a molecular weight of 530.07 g/mol. Its IUPAC name is N-butyl-4-[[5-(3-chloro-N-ethyl-4-methoxyanilino)-1H-pyrrolo[2,3-b]pyridin-3-yl]methyl]indole-1-carboxamide.
| Compound Name | N-butyl-4-[[5-(3-chloro-N-ethyl-4-methoxyanilino)-1H-pyrrolo[2,3-b]pyridin-3-yl]methyl]indole-1-carboxamide |
|---|---|
| PubChem CID | 58087653 |
| Molecular Formula | C30H32ClN5O2 |
| Molecular Weight | 530.07 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | N-butyl-4-[[5-(3-chloro-N-ethyl-4-methoxyanilino)-1H-pyrrolo[2,3-b]pyridin-3-yl]methyl]indole-1-carboxamide |
| SMILES | CCCCNC(=O)n1ccc2c(Cc3c[nH]c4ncc(N(CC)c5ccc(OC)c(Cl)c5)cc34)cccc21 |
| InChI | InChI=1S/C30H32ClN5O2/c1-4-6-13-32-30(37)36-14-12-24-20(8-7-9-27(24)36)15-21-18-33-29-25(21)16-23(19-34-29)35(5-2)22-10-11-28(38-3)26(31)17-22/h7-12,14,16-19H,4-6,13,15H2,1-3H3,(H,32,37)(H,33,34) |
| InChIKey | ILLMDJIPNFVMSO-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.07 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|