C30H25F2N3O5S — CID 58087940
N-[2,4-difluoro-3-[5-[4-(2-methoxyethoxy)phenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-4-methylbenzenesulfonamide (PubChem CID 58087940) has the molecular formula C30H25F2N3O5S and a molecular weight of 577.61 g/mol. Its IUPAC name is N-[2,4-difluoro-3-[5-[4-(2-methoxyethoxy)phenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2,4-difluoro-3-[5-[4-(2-methoxyethoxy)phenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 58087940 |
| Molecular Formula | C30H25F2N3O5S |
| Molecular Weight | 577.61 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | N-[2,4-difluoro-3-[5-[4-(2-methoxyethoxy)phenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-4-methylbenzenesulfonamide |
| SMILES | COCCOc1ccc(-c2cnc3[nH]cc(C(=O)c4c(F)ccc(NS(=O)(=O)c5ccc(C)cc5)c4F)c3c2)cc1 |
| InChI | InChI=1S/C30H25F2N3O5S/c1-18-3-9-22(10-4-18)41(37,38)35-26-12-11-25(31)27(28(26)32)29(36)24-17-34-30-23(24)15-20(16-33-30)19-5-7-21(8-6-19)40-14-13-39-2/h3-12,15-17,35H,13-14H2,1-2H3,(H,33,34) |
| InChIKey | DEASINLDOSMTOM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.61 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|