C22H27NO5 — CID 58088481
5-[cyclohexyl-(4-methoxy-1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 58088481) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is 5-[cyclohexyl-(4-methoxy-1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[cyclohexyl-(4-methoxy-1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 58088481 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 5-[cyclohexyl-(4-methoxy-1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | COc1cccc2[nH]cc(C(C3CCCCC3)C3C(=O)OC(C)(C)OC3=O)c12 |
| InChI | InChI=1S/C22H27NO5/c1-22(2)27-20(24)19(21(25)28-22)17(13-8-5-4-6-9-13)14-12-23-15-10-7-11-16(26-3)18(14)15/h7,10-13,17,19,23H,4-6,8-9H2,1-3H3 |
| InChIKey | NDDJGQPMWHNFIL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|