C30H30ClN5O2 — CID 58089046
3-[5-amino-4-[3-[[2-(3-chlorophenyl)ethylamino]methyl]benzoyl]pyrazol-1-yl]-N-cyclopropyl-4-methylbenzamide (PubChem CID 58089046) has the molecular formula C30H30ClN5O2 and a molecular weight of 528.06 g/mol. Its IUPAC name is 3-[5-amino-4-[3-[[2-(3-chlorophenyl)ethylamino]methyl]benzoyl]pyrazol-1-yl]-N-cyclopropyl-4-methylbenzamide.
| Compound Name | 3-[5-amino-4-[3-[[2-(3-chlorophenyl)ethylamino]methyl]benzoyl]pyrazol-1-yl]-N-cyclopropyl-4-methylbenzamide |
|---|---|
| PubChem CID | 58089046 |
| Molecular Formula | C30H30ClN5O2 |
| Molecular Weight | 528.06 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 3-[5-amino-4-[3-[[2-(3-chlorophenyl)ethylamino]methyl]benzoyl]pyrazol-1-yl]-N-cyclopropyl-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CC2)cc1-n1ncc(C(=O)c2cccc(CNCCc3cccc(Cl)c3)c2)c1N |
| InChI | InChI=1S/C30H30ClN5O2/c1-19-8-9-23(30(38)35-25-10-11-25)16-27(19)36-29(32)26(18-34-36)28(37)22-6-2-5-21(14-22)17-33-13-12-20-4-3-7-24(31)15-20/h2-9,14-16,18,25,33H,10-13,17,32H2,1H3,(H,35,38) |
| InChIKey | RXPMDLIAHNWJJT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.06 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|