C8H8N2OS — CID 58089077
3-ethyl-5-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 58089077) has the molecular formula C8H8N2OS and a molecular weight of 180.23 g/mol. Its IUPAC name is 3-ethyl-5-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 3-ethyl-5-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 58089077 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 3-ethyl-5-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | CCc1noc(-c2cccs2)n1 |
| InChI | InChI=1S/C8H8N2OS/c1-2-7-9-8(11-10-7)6-4-3-5-12-6/h3-5H,2H2,1H3 |
| InChIKey | ABKNQRQCTDGCCA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |