C36H24Cl2N4O4Ru — CID 58089473
dichlororuthenium;4,7-diphenyl-1,10-phenanthroline;2-(4-formyloxy-2-pyridinyl)pyridine-4-carboxylic acid (PubChem CID 58089473) has the molecular formula C36H24Cl2N4O4Ru and a molecular weight of 748.59 g/mol. Its IUPAC name is dichlororuthenium;4,7-diphenyl-1,10-phenanthroline;2-(4-formyloxy-2-pyridinyl)pyridine-4-carboxylic acid.
| Compound Name | dichlororuthenium;4,7-diphenyl-1,10-phenanthroline;2-(4-formyloxy-2-pyridinyl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 58089473 |
| Molecular Formula | C36H24Cl2N4O4Ru |
| Molecular Weight | 748.59 g/mol |
| Exact Mass | 748.02 |
| IUPAC Name | dichlororuthenium;4,7-diphenyl-1,10-phenanthroline;2-(4-formyloxy-2-pyridinyl)pyridine-4-carboxylic acid |
| SMILES | Cl[Ru]Cl.O=COc1ccnc(-c2cc(C(=O)O)ccn2)c1.c1ccc(-c2ccnc3c2ccc2c(-c4ccccc4)ccnc23)cc1 |
| InChI | InChI=1S/C24H16N2.C12H8N2O4.2ClH.Ru/c1-3-7-17(8-4-1)19-13-15-25-23-21(19)11-12-22-20(14-16-26-24(22)23)18-9-5-2-6-10-18;15-7-18-9-2-4-14-11(6-9)10-5-8(12(16)17)1-3-13-10;;;/h1-16H;1-7H,(H,16,17);2*1H;/q;;;;+2/p-2 |
| InChIKey | WMXRYSXSKQHYPY-UHFFFAOYSA-L |
| XLogP | 8.87 |
| TPSA | 115.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.59 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|