About 5-methyl-1'-(oxan-4-yl)spiro[2-benzofuran-3,4'-piperidine]-1-one
5-methyl-1'-(oxan-4-yl)spiro[2-benzofuran-3,4'-piperidine]-1-one (PubChem CID 58089586) has the molecular formula C18H23NO3
and a molecular weight of 301.39 g/mol. Its IUPAC name is 5-methyl-1'-(oxan-4-yl)spiro[2-benzofuran-3,4'-piperidine]-1-one.
Molecular Properties
| Compound Name | 5-methyl-1'-(oxan-4-yl)spiro[2-benzofuran-3,4'-piperidine]-1-one |
| PubChem CID | 58089586 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 5-methyl-1'-(oxan-4-yl)spiro[2-benzofuran-3,4'-piperidine]-1-one |
| SMILES | Cc1ccc2c(c1)C1(CCN(C3CCOCC3)CC1)OC2=O |
| InChI | InChI=1S/C18H23NO3/c1-13-2-3-15-16(12-13)18(22-17(15)20)6-8-19(9-7-18)14-4-10-21-11-5-14/h2-3,12,14H,4-11H2,1H3 |
| InChIKey | BGDFRMVUWMTHMO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-1'-(oxan-4-yl)spiro[2-benzofuran-3,4'-piperidine]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1'-(oxan-4-yl)spiro[2-benzofuran-3,4'-piperidine]-1-one?
The IUPAC name of 5-methyl-1'-(oxan-4-yl)spiro[2-benzofuran-3,4'-piperidine]-1-one (CID 58089586) is 5-methyl-1'-(oxan-4-yl)spiro[2-benzofuran-3,4'-piperidine]-1-one.
What is the SMILES notation for 5-methyl-1'-(oxan-4-yl)spiro[2-benzofuran-3,4'-piperidine]-1-one?
The canonical SMILES for 5-methyl-1'-(oxan-4-yl)spiro[2-benzofuran-3,4'-piperidine]-1-one is Cc1ccc2c(c1)C1(CCN(C3CCOCC3)CC1)OC2=O.
What is the InChIKey of 5-methyl-1'-(oxan-4-yl)spiro[2-benzofuran-3,4'-piperidine]-1-one?
The InChIKey is BGDFRMVUWMTHMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO3/c1-13-2-3-15-16(12-13)18(22-17(15)20)6-8-19(9-7-18)14-4-10-21-11-5-14/h2-3,12,14H,4-11H2,1H3.
What are the key properties of 5-methyl-1'-(oxan-4-yl)spiro[2-benzofuran-3,4'-piperidine]-1-one?
5-methyl-1'-(oxan-4-yl)spiro[2-benzofuran-3,4'-piperidine]-1-one has a molecular weight of 301.39 g/mol, XLogP of 2.64, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1'-(oxan-4-yl)spiro[2-benzofuran-3,4'-piperidine]-1-one is sourced from PubChem (CID 58089586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).