C7H13F3N2 — CID 58089920
2,2-dimethyl-N'-(2,2,2-trifluoroethyl)propanimidamide (PubChem CID 58089920) has the molecular formula C7H13F3N2 and a molecular weight of 182.19 g/mol. Its IUPAC name is 2,2-dimethyl-N'-(2,2,2-trifluoroethyl)propanimidamide.
| Compound Name | 2,2-dimethyl-N'-(2,2,2-trifluoroethyl)propanimidamide |
|---|---|
| PubChem CID | 58089920 |
| Molecular Formula | C7H13F3N2 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.10 |
| IUPAC Name | 2,2-dimethyl-N'-(2,2,2-trifluoroethyl)propanimidamide |
| SMILES | CC(C)(C)/C(N)=N/CC(F)(F)F |
| InChI | InChI=1S/C7H13F3N2/c1-6(2,3)5(11)12-4-7(8,9)10/h4H2,1-3H3,(H2,11,12) |
| InChIKey | LWHMBHJEPCMXIU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|