C13H25N3S — CID 58089988
(1S)-1-[4-(2,2-dimethylpropyl)-1,3-thiazol-2-yl]pentane-1,5-diamine (PubChem CID 58089988) has the molecular formula C13H25N3S and a molecular weight of 255.43 g/mol. Its IUPAC name is (1S)-1-[4-(2,2-dimethylpropyl)-1,3-thiazol-2-yl]pentane-1,5-diamine.
| Compound Name | (1S)-1-[4-(2,2-dimethylpropyl)-1,3-thiazol-2-yl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 58089988 |
| Molecular Formula | C13H25N3S |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | (1S)-1-[4-(2,2-dimethylpropyl)-1,3-thiazol-2-yl]pentane-1,5-diamine |
| SMILES | CC(C)(C)Cc1csc([C@@H](N)CCCCN)n1 |
| InChI | InChI=1S/C13H25N3S/c1-13(2,3)8-10-9-17-12(16-10)11(15)6-4-5-7-14/h9,11H,4-8,14-15H2,1-3H3/t11-/m0/s1 |
| InChIKey | MFPUQFIFGFNMCN-NSHDSACASA-N |
| XLogP | 2.86 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|