C46H28N10O4 — CID 58090457
5-[2,5-dinitro-3,4,6-tris(6-pyridin-2-yl-3-pyridinyl)phenyl]-2-pyridin-2-ylpyridine (PubChem CID 58090457) has the molecular formula C46H28N10O4 and a molecular weight of 784.80 g/mol. Its IUPAC name is 5-[2,5-dinitro-3,4,6-tris(6-pyridin-2-yl-3-pyridinyl)phenyl]-2-pyridin-2-ylpyridine.
| Compound Name | 5-[2,5-dinitro-3,4,6-tris(6-pyridin-2-yl-3-pyridinyl)phenyl]-2-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 58090457 |
| Molecular Formula | C46H28N10O4 |
| Molecular Weight | 784.80 g/mol |
| Exact Mass | 784.23 |
| IUPAC Name | 5-[2,5-dinitro-3,4,6-tris(6-pyridin-2-yl-3-pyridinyl)phenyl]-2-pyridin-2-ylpyridine |
| SMILES | O=[N+]([O-])c1c(-c2ccc(-c3ccccn3)nc2)c(-c2ccc(-c3ccccn3)nc2)c([N+](=O)[O-])c(-c2ccc(-c3ccccn3)nc2)c1-c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C46H28N10O4/c57-55(58)45-41(29-13-17-37(51-25-29)33-9-1-5-21-47-33)42(30-14-18-38(52-26-30)34-10-2-6-22-48-34)46(56(59)60)44(32-16-20-40(54-28-32)36-12-4-8-24-50-36)43(45)31-15-19-39(53-27-31)35-11-3-7-23-49-35/h1-28H |
| InChIKey | GPIIMSPUXCLYKQ-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 189.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.80 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|