C25H24N4O2 — CID 58090677
4,6-bis[(3-methoxyphenyl)methyl]-N-phenyl-1,3,5-triazin-2-amine (PubChem CID 58090677) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 4,6-bis[(3-methoxyphenyl)methyl]-N-phenyl-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis[(3-methoxyphenyl)methyl]-N-phenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 58090677 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 4,6-bis[(3-methoxyphenyl)methyl]-N-phenyl-1,3,5-triazin-2-amine |
| SMILES | COc1cccc(Cc2nc(Cc3cccc(OC)c3)nc(Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C25H24N4O2/c1-30-21-12-6-8-18(14-21)16-23-27-24(17-19-9-7-13-22(15-19)31-2)29-25(28-23)26-20-10-4-3-5-11-20/h3-15H,16-17H2,1-2H3,(H,26,27,28,29) |
| InChIKey | KEOFBOMETYIZEQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |