C28H28N4O2 — CID 58090730
ethyl 4-[[4,6-bis[(4-methylphenyl)methyl]-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 58090730) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is ethyl 4-[[4,6-bis[(4-methylphenyl)methyl]-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4,6-bis[(4-methylphenyl)methyl]-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 58090730 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | ethyl 4-[[4,6-bis[(4-methylphenyl)methyl]-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(Cc3ccc(C)cc3)nc(Cc3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C28H28N4O2/c1-4-34-27(33)23-13-15-24(16-14-23)29-28-31-25(17-21-9-5-19(2)6-10-21)30-26(32-28)18-22-11-7-20(3)8-12-22/h5-16H,4,17-18H2,1-3H3,(H,29,30,31,32) |
| InChIKey | OGULOPPBXSSKEW-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |