C19H26N6O — CID 58090880
1-(4-cyclobutylpiperazin-1-yl)-2-(1,3,4,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-11-yl)ethanone (PubChem CID 58090880) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 1-(4-cyclobutylpiperazin-1-yl)-2-(1,3,4,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-11-yl)ethanone.
| Compound Name | 1-(4-cyclobutylpiperazin-1-yl)-2-(1,3,4,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-11-yl)ethanone |
|---|---|
| PubChem CID | 58090880 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 1-(4-cyclobutylpiperazin-1-yl)-2-(1,3,4,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-11-yl)ethanone |
| SMILES | O=C(CN1CCn2c(cc3ccnnc32)C1)N1CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C19H26N6O/c26-18(24-9-7-23(8-10-24)16-2-1-3-16)14-22-6-11-25-17(13-22)12-15-4-5-20-21-19(15)25/h4-5,12,16H,1-3,6-11,13-14H2 |
| InChIKey | YZFORZXGOBJXSS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |