C9H18N2O — CID 58090982
4-methyl-1,3-di(propan-2-yl)-1,3-diazetidin-2-one (PubChem CID 58090982) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 4-methyl-1,3-di(propan-2-yl)-1,3-diazetidin-2-one.
| Compound Name | 4-methyl-1,3-di(propan-2-yl)-1,3-diazetidin-2-one |
|---|---|
| PubChem CID | 58090982 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 4-methyl-1,3-di(propan-2-yl)-1,3-diazetidin-2-one |
| SMILES | CC(C)N1C(=O)N(C(C)C)C1C |
| InChI | InChI=1S/C9H18N2O/c1-6(2)10-8(5)11(7(3)4)9(10)12/h6-8H,1-5H3 |
| InChIKey | UJCMNOGTGBTCMN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |