C17H27NO4 — CID 58091446
(2S)-2-cyclohexyl-4-oxo-4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]butanoic acid (PubChem CID 58091446) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-4-oxo-4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]butanoic acid.
| Compound Name | (2S)-2-cyclohexyl-4-oxo-4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 58091446 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (2S)-2-cyclohexyl-4-oxo-4-[(3R)-3-prop-2-enoxypyrrolidin-1-yl]butanoic acid |
| SMILES | C=CCO[C@@H]1CCN(C(=O)C[C@H](C(=O)O)C2CCCCC2)C1 |
| InChI | InChI=1S/C17H27NO4/c1-2-10-22-14-8-9-18(12-14)16(19)11-15(17(20)21)13-6-4-3-5-7-13/h2,13-15H,1,3-12H2,(H,20,21)/t14-,15+/m1/s1 |
| InChIKey | ZJUZEUNLGDKTCC-CABCVRRESA-N |
| XLogP | 2.46 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|