C8H15NO — CID 580917
N-(3,5-dimethylcyclohexylidene)hydroxylamine (PubChem CID 580917) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is N-(3,5-dimethylcyclohexylidene)hydroxylamine.
| Compound Name | N-(3,5-dimethylcyclohexylidene)hydroxylamine |
|---|---|
| PubChem CID | 580917 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | N-(3,5-dimethylcyclohexylidene)hydroxylamine |
| SMILES | CC1CC(=NO)CC(C)C1 |
| InChI | InChI=1S/C8H15NO/c1-6-3-7(2)5-8(4-6)9-10/h6-7,10H,3-5H2,1-2H3 |
| InChIKey | BTZZWXZMJCHUFK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|