C18H21F5O7S — CID 58091847
1,1,3,3,3-pentafluoro-2-[2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)acetyl]oxypropane-1-sulfonic acid (PubChem CID 58091847) has the molecular formula C18H21F5O7S and a molecular weight of 476.42 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-[2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)acetyl]oxypropane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-[2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)acetyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58091847 |
| Molecular Formula | C18H21F5O7S |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-[2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)acetyl]oxypropane-1-sulfonic acid |
| SMILES | O=C(COC(=O)C1CC2CC1C1C3CCC(C3)C21)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C18H21F5O7S/c19-17(20,21)16(18(22,23)31(26,27)28)30-12(24)6-29-15(25)11-5-9-4-10(11)14-8-2-1-7(3-8)13(9)14/h7-11,13-14,16H,1-6H2,(H,26,27,28) |
| InChIKey | OQOIXCTULJWREF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|