C17H22F2O7S — CID 58091860
1,1-difluoro-2-[2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)acetyl]oxyethanesulfonic acid (PubChem CID 58091860) has the molecular formula C17H22F2O7S and a molecular weight of 408.42 g/mol. Its IUPAC name is 1,1-difluoro-2-[2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)acetyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)acetyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 58091860 |
| Molecular Formula | C17H22F2O7S |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 1,1-difluoro-2-[2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)acetyl]oxyethanesulfonic acid |
| SMILES | O=C(COC(=O)C1CC2CC1C1C3CCC(C3)C21)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C17H22F2O7S/c18-17(19,27(22,23)24)7-26-13(20)6-25-16(21)12-5-10-4-11(12)15-9-2-1-8(3-9)14(10)15/h8-12,14-15H,1-7H2,(H,22,23,24) |
| InChIKey | KABLLOXFVXMTDD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|