C12H12F2O10S — CID 58091928
1,1-difluoro-2-[2-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxyacetyl]oxyethanesulfonic acid (PubChem CID 58091928) has the molecular formula C12H12F2O10S and a molecular weight of 386.28 g/mol. Its IUPAC name is 1,1-difluoro-2-[2-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxyacetyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxyacetyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 58091928 |
| Molecular Formula | C12H12F2O10S |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 1,1-difluoro-2-[2-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxyacetyl]oxyethanesulfonic acid |
| SMILES | O=C(COC(=O)C1C2CC3OC(=O)C1C3O2)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C12H12F2O10S/c13-12(14,25(18,19)20)3-22-6(15)2-21-10(16)7-4-1-5-9(23-4)8(7)11(17)24-5/h4-5,7-9H,1-3H2,(H,18,19,20) |
| InChIKey | YFWDBRKBWCAURV-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|