C35H60F6O8 — CID 58091967
1-O-(1,1,1-trifluoro-2-hydroxy-2,6-dimethylheptan-4-yl) 5-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 3-O-(2,3,3-trimethylbutan-2-yl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate (PubChem CID 58091967) has the molecular formula C35H60F6O8 and a molecular weight of 722.85 g/mol. Its IUPAC name is 1-O-(1,1,1-trifluoro-2-hydroxy-2,6-dimethylheptan-4-yl) 5-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 3-O-(2,3,3-trimethylbutan-2-yl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-(1,1,1-trifluoro-2-hydroxy-2,6-dimethylheptan-4-yl) 5-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 3-O-(2,3,3-trimethylbutan-2-yl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 58091967 |
| Molecular Formula | C35H60F6O8 |
| Molecular Weight | 722.85 g/mol |
| Exact Mass | 722.42 |
| IUPAC Name | 1-O-(1,1,1-trifluoro-2-hydroxy-2,6-dimethylheptan-4-yl) 5-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 3-O-(2,3,3-trimethylbutan-2-yl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(CC(C)(C)C(=O)OC(CC(C)C)CC(C)(O)C(F)(F)F)C(=O)OC(C)(C)C(C)(C)C)C(=O)OC(C)CC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C35H60F6O8/c1-15-31(12,27(44)47-22(4)17-32(13,45)34(36,37)38)19-23(25(42)49-30(10,11)28(5,6)7)18-29(8,9)26(43)48-24(16-21(2)3)20-33(14,46)35(39,40)41/h21-24,45-46H,15-20H2,1-14H3 |
| InChIKey | USYJMRCASLZLEL-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.85 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|