C34H49F3O6 — CID 58091968
1-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 7-O-(2,3,3-trimethylbutan-2-yl) 2-ethyl-4-(6-hydroxynaphthalen-2-yl)-2,6-dimethylheptanedioate (PubChem CID 58091968) has the molecular formula C34H49F3O6 and a molecular weight of 610.75 g/mol. Its IUPAC name is 1-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 7-O-(2,3,3-trimethylbutan-2-yl) 2-ethyl-4-(6-hydroxynaphthalen-2-yl)-2,6-dimethylheptanedioate.
| Compound Name | 1-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 7-O-(2,3,3-trimethylbutan-2-yl) 2-ethyl-4-(6-hydroxynaphthalen-2-yl)-2,6-dimethylheptanedioate |
|---|---|
| PubChem CID | 58091968 |
| Molecular Formula | C34H49F3O6 |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.35 |
| IUPAC Name | 1-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 7-O-(2,3,3-trimethylbutan-2-yl) 2-ethyl-4-(6-hydroxynaphthalen-2-yl)-2,6-dimethylheptanedioate |
| SMILES | CCC(C)(CC(CC(C)C(=O)OC(C)(C)C(C)(C)C)c1ccc2cc(O)ccc2c1)C(=O)OC(C)CC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C34H49F3O6/c1-11-32(9,29(40)42-22(3)19-33(10,41)34(35,36)37)20-26(16-21(2)28(39)43-31(7,8)30(4,5)6)24-12-13-25-18-27(38)15-14-23(25)17-24/h12-15,17-18,21-22,26,38,41H,11,16,19-20H2,1-10H3 |
| InChIKey | FUYQBXVKPZKWBF-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |