About 3-(15N)azanyloxy(1,2,3-13C3)propyl(trimethyl)azanium
3-(15N)azanyloxy(1,2,3-13C3)propyl(trimethyl)azanium (PubChem CID 58091997) has the molecular formula C6H17N2O+
and a molecular weight of 137.19 g/mol. Its IUPAC name is 3-(15N)azanyloxy(1,2,3-13C3)propyl(trimethyl)azanium.
Molecular Properties
| Compound Name | 3-(15N)azanyloxy(1,2,3-13C3)propyl(trimethyl)azanium |
| PubChem CID | 58091997 |
| Molecular Formula | C6H17N2O+ |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.14 |
| IUPAC Name | 3-(15N)azanyloxy(1,2,3-13C3)propyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)[13CH2][13CH2][13CH2]O[15NH2] |
| InChI | InChI=1S/C6H17N2O/c1-8(2,3)5-4-6-9-7/h4-7H2,1-3H3/q+1/i4+1,5+1,6+1,7+1 |
| InChIKey | QVIKARDLNJZIDR-SQLBHGNYSA-N |
| XLogP | -0.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(15N)azanyloxy(1,2,3-13C3)propyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(15N)azanyloxy(1,2,3-13C3)propyl(trimethyl)azanium?
The IUPAC name of 3-(15N)azanyloxy(1,2,3-13C3)propyl(trimethyl)azanium (CID 58091997) is 3-(15N)azanyloxy(1,2,3-13C3)propyl(trimethyl)azanium.
What is the SMILES notation for 3-(15N)azanyloxy(1,2,3-13C3)propyl(trimethyl)azanium?
The canonical SMILES for 3-(15N)azanyloxy(1,2,3-13C3)propyl(trimethyl)azanium is C[N+](C)(C)[13CH2][13CH2][13CH2]O[15NH2].
What is the InChIKey of 3-(15N)azanyloxy(1,2,3-13C3)propyl(trimethyl)azanium?
The InChIKey is QVIKARDLNJZIDR-SQLBHGNYSA-N. The full InChI is InChI=1S/C6H17N2O/c1-8(2,3)5-4-6-9-7/h4-7H2,1-3H3/q+1/i4+1,5+1,6+1,7+1.
What are the key properties of 3-(15N)azanyloxy(1,2,3-13C3)propyl(trimethyl)azanium?
3-(15N)azanyloxy(1,2,3-13C3)propyl(trimethyl)azanium has a molecular weight of 137.19 g/mol, XLogP of -0.03, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(15N)azanyloxy(1,2,3-13C3)propyl(trimethyl)azanium is sourced from PubChem (CID 58091997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).