C30H31FN4O4 — CID 58092195
tert-butyl 6-[4-[(5-fluoro-2-pyridinyl)methoxy]-2-oxo-1-pyridinyl]-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-15-carboxylate (PubChem CID 58092195) has the molecular formula C30H31FN4O4 and a molecular weight of 530.60 g/mol. Its IUPAC name is tert-butyl 6-[4-[(5-fluoro-2-pyridinyl)methoxy]-2-oxo-1-pyridinyl]-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-15-carboxylate.
| Compound Name | tert-butyl 6-[4-[(5-fluoro-2-pyridinyl)methoxy]-2-oxo-1-pyridinyl]-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-15-carboxylate |
|---|---|
| PubChem CID | 58092195 |
| Molecular Formula | C30H31FN4O4 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | tert-butyl 6-[4-[(5-fluoro-2-pyridinyl)methoxy]-2-oxo-1-pyridinyl]-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-15-carboxylate |
| SMILES | Cn1c2c(c3ccc(-n4ccc(OCc5ccc(F)cn5)cc4=O)cc31)C1CCC(C2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H31FN4O4/c1-30(2,3)39-29(37)35-21-8-10-24(35)28-23-9-7-20(13-25(23)33(4)26(28)14-21)34-12-11-22(15-27(34)36)38-17-19-6-5-18(31)16-32-19/h5-7,9,11-13,15-16,21,24H,8,10,14,17H2,1-4H3 |
| InChIKey | KBLGKQXDZYNMDJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 78.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|