C26H26N4O2 — CID 58092269
1-(8-methyl-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-5-yl)-4-phenylmethoxypyridin-2-one (PubChem CID 58092269) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 1-(8-methyl-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-5-yl)-4-phenylmethoxypyridin-2-one.
| Compound Name | 1-(8-methyl-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-5-yl)-4-phenylmethoxypyridin-2-one |
|---|---|
| PubChem CID | 58092269 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 1-(8-methyl-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-5-yl)-4-phenylmethoxypyridin-2-one |
| SMILES | Cn1c2c(c3ccc(-n4ccc(OCc5ccccc5)cc4=O)nc31)CN1CCCC1C2 |
| InChI | InChI=1S/C26H26N4O2/c1-28-23-14-19-8-5-12-29(19)16-22(23)21-9-10-24(27-26(21)28)30-13-11-20(15-25(30)31)32-17-18-6-3-2-4-7-18/h2-4,6-7,9-11,13,15,19H,5,8,12,14,16-17H2,1H3 |
| InChIKey | XSRCSDPPGHTDIE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |