C25H23ClFN5O2 — CID 58092283
4-[(5-chloro-3-fluoro-2-pyridinyl)methoxy]-1-(8-methyl-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one (PubChem CID 58092283) has the molecular formula C25H23ClFN5O2 and a molecular weight of 479.94 g/mol. Its IUPAC name is 4-[(5-chloro-3-fluoro-2-pyridinyl)methoxy]-1-(8-methyl-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one.
| Compound Name | 4-[(5-chloro-3-fluoro-2-pyridinyl)methoxy]-1-(8-methyl-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one |
|---|---|
| PubChem CID | 58092283 |
| Molecular Formula | C25H23ClFN5O2 |
| Molecular Weight | 479.94 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 4-[(5-chloro-3-fluoro-2-pyridinyl)methoxy]-1-(8-methyl-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one |
| SMILES | Cn1c2c(c3ccc(-n4ccc(OCc5ncc(Cl)cc5F)cc4=O)nc31)CN1CCCC1C2 |
| InChI | InChI=1S/C25H23ClFN5O2/c1-30-22-10-16-3-2-7-31(16)13-19(22)18-4-5-23(29-25(18)30)32-8-6-17(11-24(32)33)34-14-21-20(27)9-15(26)12-28-21/h4-6,8-9,11-12,16H,2-3,7,10,13-14H2,1H3 |
| InChIKey | BMVSPMPDEDUYPD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.94 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |