C26H24ClFN4O2 — CID 58092307
4-[(4-chloro-2-fluorophenyl)methoxy]-1-(10-methyl-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-13-yl)pyridin-2-one (PubChem CID 58092307) has the molecular formula C26H24ClFN4O2 and a molecular weight of 478.96 g/mol. Its IUPAC name is 4-[(4-chloro-2-fluorophenyl)methoxy]-1-(10-methyl-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-13-yl)pyridin-2-one.
| Compound Name | 4-[(4-chloro-2-fluorophenyl)methoxy]-1-(10-methyl-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-13-yl)pyridin-2-one |
|---|---|
| PubChem CID | 58092307 |
| Molecular Formula | C26H24ClFN4O2 |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 4-[(4-chloro-2-fluorophenyl)methoxy]-1-(10-methyl-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-13-yl)pyridin-2-one |
| SMILES | Cn1c2c(c3ccc(-n4ccc(OCc5ccc(Cl)cc5F)cc4=O)nc31)C1CCCN1CC2 |
| InChI | InChI=1S/C26H24ClFN4O2/c1-30-21-9-11-31-10-2-3-22(31)25(21)19-6-7-23(29-26(19)30)32-12-8-18(14-24(32)33)34-15-16-4-5-17(27)13-20(16)28/h4-8,12-14,22H,2-3,9-11,15H2,1H3 |
| InChIKey | LQGBWJGJTAOBDA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |