C16H18Cl3FN2O2 — CID 58092774
(3R,7aR)-7a-[[(3-fluorophenyl)methyl-methylamino]methyl]-3-(trichloromethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one (PubChem CID 58092774) has the molecular formula C16H18Cl3FN2O2 and a molecular weight of 395.69 g/mol. Its IUPAC name is (3R,7aR)-7a-[[(3-fluorophenyl)methyl-methylamino]methyl]-3-(trichloromethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one.
| Compound Name | (3R,7aR)-7a-[[(3-fluorophenyl)methyl-methylamino]methyl]-3-(trichloromethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one |
|---|---|
| PubChem CID | 58092774 |
| Molecular Formula | C16H18Cl3FN2O2 |
| Molecular Weight | 395.69 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | (3R,7aR)-7a-[[(3-fluorophenyl)methyl-methylamino]methyl]-3-(trichloromethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one |
| SMILES | CN(Cc1cccc(F)c1)C[C@@]12CCCN1[C@@H](C(Cl)(Cl)Cl)OC2=O |
| InChI | InChI=1S/C16H18Cl3FN2O2/c1-21(9-11-4-2-5-12(20)8-11)10-15-6-3-7-22(15)13(16(17,18)19)24-14(15)23/h2,4-5,8,13H,3,6-7,9-10H2,1H3/t13-,15-/m1/s1 |
| InChIKey | SZTBUTPPXISQSF-UKRRQHHQSA-N |
| XLogP | 3.35 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.69 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|