About 2-methylbutan-2-yl 2,6-dichloro-4-(2-methylbutan-2-yloxycarbonylamino)pyridine-3-carboxylate
2-methylbutan-2-yl 2,6-dichloro-4-(2-methylbutan-2-yloxycarbonylamino)pyridine-3-carboxylate (PubChem CID 58093124) has the molecular formula C17H24Cl2N2O4
and a molecular weight of 391.30 g/mol. Its IUPAC name is 2-methylbutan-2-yl 2,6-dichloro-4-(2-methylbutan-2-yloxycarbonylamino)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | 2-methylbutan-2-yl 2,6-dichloro-4-(2-methylbutan-2-yloxycarbonylamino)pyridine-3-carboxylate |
| PubChem CID | 58093124 |
| Molecular Formula | C17H24Cl2N2O4 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 2-methylbutan-2-yl 2,6-dichloro-4-(2-methylbutan-2-yloxycarbonylamino)pyridine-3-carboxylate |
| SMILES | CCC(C)(C)OC(=O)Nc1cc(Cl)nc(Cl)c1C(=O)OC(C)(C)CC |
| InChI | InChI=1S/C17H24Cl2N2O4/c1-7-16(3,4)24-14(22)12-10(9-11(18)21-13(12)19)20-15(23)25-17(5,6)8-2/h9H,7-8H2,1-6H3,(H,20,21,23) |
| InChIKey | BTSYZHRQYSPFIC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutan-2-yl 2,6-dichloro-4-(2-methylbutan-2-yloxycarbonylamino)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-yl 2,6-dichloro-4-(2-methylbutan-2-yloxycarbonylamino)pyridine-3-carboxylate?
The IUPAC name of 2-methylbutan-2-yl 2,6-dichloro-4-(2-methylbutan-2-yloxycarbonylamino)pyridine-3-carboxylate (CID 58093124) is 2-methylbutan-2-yl 2,6-dichloro-4-(2-methylbutan-2-yloxycarbonylamino)pyridine-3-carboxylate.
What is the SMILES notation for 2-methylbutan-2-yl 2,6-dichloro-4-(2-methylbutan-2-yloxycarbonylamino)pyridine-3-carboxylate?
The canonical SMILES for 2-methylbutan-2-yl 2,6-dichloro-4-(2-methylbutan-2-yloxycarbonylamino)pyridine-3-carboxylate is CCC(C)(C)OC(=O)Nc1cc(Cl)nc(Cl)c1C(=O)OC(C)(C)CC.
What is the InChIKey of 2-methylbutan-2-yl 2,6-dichloro-4-(2-methylbutan-2-yloxycarbonylamino)pyridine-3-carboxylate?
The InChIKey is BTSYZHRQYSPFIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24Cl2N2O4/c1-7-16(3,4)24-14(22)12-10(9-11(18)21-13(12)19)20-15(23)25-17(5,6)8-2/h9H,7-8H2,1-6H3,(H,20,21,23).
What are the key properties of 2-methylbutan-2-yl 2,6-dichloro-4-(2-methylbutan-2-yloxycarbonylamino)pyridine-3-carboxylate?
2-methylbutan-2-yl 2,6-dichloro-4-(2-methylbutan-2-yloxycarbonylamino)pyridine-3-carboxylate has a molecular weight of 391.30 g/mol, XLogP of 5.47, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-yl 2,6-dichloro-4-(2-methylbutan-2-yloxycarbonylamino)pyridine-3-carboxylate is sourced from PubChem (CID 58093124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).