C6H12N2O2 — CID 58093298
(5S)-5-(aminomethyl)-3-methyl-1,3-oxazinan-2-one (PubChem CID 58093298) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is (5S)-5-(aminomethyl)-3-methyl-1,3-oxazinan-2-one.
| Compound Name | (5S)-5-(aminomethyl)-3-methyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 58093298 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | (5S)-5-(aminomethyl)-3-methyl-1,3-oxazinan-2-one |
| SMILES | CN1C[C@H](CN)COC1=O |
| InChI | InChI=1S/C6H12N2O2/c1-8-3-5(2-7)4-10-6(8)9/h5H,2-4,7H2,1H3/t5-/m0/s1 |
| InChIKey | ZKTOABQEGSVXST-YFKPBYRVSA-N |
| XLogP | -0.36 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |