C23H22ClN5O2 — CID 58093339
4-[(5-chloro-2-pyridinyl)methoxy]-1-(8-methyl-6,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one (PubChem CID 58093339) has the molecular formula C23H22ClN5O2 and a molecular weight of 435.92 g/mol. Its IUPAC name is 4-[(5-chloro-2-pyridinyl)methoxy]-1-(8-methyl-6,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one.
| Compound Name | 4-[(5-chloro-2-pyridinyl)methoxy]-1-(8-methyl-6,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one |
|---|---|
| PubChem CID | 58093339 |
| Molecular Formula | C23H22ClN5O2 |
| Molecular Weight | 435.92 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 4-[(5-chloro-2-pyridinyl)methoxy]-1-(8-methyl-6,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one |
| SMILES | Cn1c2c(c3ccc(-n4ccc(OCc5ccc(Cl)cn5)cc4=O)nc31)CCNCC2 |
| InChI | InChI=1S/C23H22ClN5O2/c1-28-20-7-10-25-9-6-18(20)19-4-5-21(27-23(19)28)29-11-8-17(12-22(29)30)31-14-16-3-2-15(24)13-26-16/h2-5,8,11-13,25H,6-7,9-10,14H2,1H3 |
| InChIKey | DUZLTGRITDJCLT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.92 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |